C16H21ClN4O2 — CID 24766735
2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl acetate;hydrochloride (PubChem CID 24766735) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl acetate;hydrochloride.
| Compound Name | 2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl acetate;hydrochloride |
|---|---|
| PubChem CID | 24766735 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl acetate;hydrochloride |
| SMILES | CC(=O)OCCNc1nc(C)cc(Nc2ccc(C)cc2)n1.Cl |
| InChI | InChI=1S/C16H20N4O2.ClH/c1-11-4-6-14(7-5-11)19-15-10-12(2)18-16(20-15)17-8-9-22-13(3)21;/h4-7,10H,8-9H2,1-3H3,(H2,17,18,19,20);1H |
| InChIKey | AEYIPZOTZYESDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|