C25H25N5O — CID 122325017
N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-1-carboxamide (PubChem CID 122325017) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 122325017 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C25H25N5O/c1-17-10-12-20(13-11-17)29-23-16-18(2)28-25(30-23)27-15-14-26-24(31)22-9-5-7-19-6-3-4-8-21(19)22/h3-13,16H,14-15H2,1-2H3,(H,26,31)(H2,27,28,29,30) |
| InChIKey | BKUPZPGZNXCMSS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|