C22H23ClFN5O — CID 122325152
2-(2-chloro-6-fluorophenyl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide (PubChem CID 122325152) has the molecular formula C22H23ClFN5O and a molecular weight of 427.91 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122325152 |
| Molecular Formula | C22H23ClFN5O |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)Cc3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H23ClFN5O/c1-14-6-8-16(9-7-14)28-20-12-15(2)27-22(29-20)26-11-10-25-21(30)13-17-18(23)4-3-5-19(17)24/h3-9,12H,10-11,13H2,1-2H3,(H,25,30)(H2,26,27,28,29) |
| InChIKey | ZIEJIZPCYVZGAF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|