C21H22F2N6O — CID 122324911
1-(3,5-difluorophenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea (PubChem CID 122324911) has the molecular formula C21H22F2N6O and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122324911 |
| Molecular Formula | C21H22F2N6O |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)Nc3cc(F)cc(F)c3)n2)cc1 |
| InChI | InChI=1S/C21H22F2N6O/c1-13-3-5-17(6-4-13)27-19-9-14(2)26-20(29-19)24-7-8-25-21(30)28-18-11-15(22)10-16(23)12-18/h3-6,9-12H,7-8H2,1-2H3,(H2,25,28,30)(H2,24,26,27,29) |
| InChIKey | NQZXIQXXRXVESC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|