C20H24N6OS — CID 122324881
2,4-dimethyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 122324881) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122324881 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2,4-dimethyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)c3sc(C)nc3C)n2)cc1 |
| InChI | InChI=1S/C20H24N6OS/c1-12-5-7-16(8-6-12)25-17-11-13(2)23-20(26-17)22-10-9-21-19(27)18-14(3)24-15(4)28-18/h5-8,11H,9-10H2,1-4H3,(H,21,27)(H2,22,23,25,26) |
| InChIKey | KDZPOBHFYAXHJQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|