C25H31N5O2 — CID 121075067
4-tert-butyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 121075067) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075067 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4-tert-butyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C25H31N5O2/c1-17-16-22(29-20-10-12-21(32-5)13-11-20)30-24(28-17)27-15-14-26-23(31)18-6-8-19(9-7-18)25(2,3)4/h6-13,16H,14-15H2,1-5H3,(H,26,31)(H2,27,28,29,30) |
| InChIKey | KXXCLLMODWYRNW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|