C20H23N7O2 — CID 122294736
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-5-methylpyrazine-2-carboxamide (PubChem CID 122294736) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122294736 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-5-methylpyrazine-2-carboxamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cnc(C)cn3)n2)cc1 |
| InChI | InChI=1S/C20H23N7O2/c1-13-10-18(26-15-4-6-16(29-3)7-5-15)27-20(25-13)22-9-8-21-19(28)17-12-23-14(2)11-24-17/h4-7,10-12H,8-9H2,1-3H3,(H,21,28)(H2,22,25,26,27) |
| InChIKey | ISNITFGKGWRWRQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|