C21H22FN5O2 — CID 121075077
3-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 121075077) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075077 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C21H22FN5O2/c1-14-12-19(26-17-6-8-18(29-2)9-7-17)27-21(25-14)24-11-10-23-20(28)15-4-3-5-16(22)13-15/h3-9,12-13H,10-11H2,1-2H3,(H,23,28)(H2,24,25,26,27) |
| InChIKey | ILENAZWOYULLHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|