C23H23F2N5O2 — CID 122294740
(E)-3-(2,5-difluorophenyl)-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]prop-2-enamide (PubChem CID 122294740) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122294740 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]prop-2-enamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)/C=C/c3cc(F)ccc3F)n2)cc1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-15-13-21(29-18-5-7-19(32-2)8-6-18)30-23(28-15)27-12-11-26-22(31)10-3-16-14-17(24)4-9-20(16)25/h3-10,13-14H,11-12H2,1-2H3,(H,26,31)(H2,27,28,29,30)/b10-3+ |
| InChIKey | BZQOVHVFVQCYRX-XCVCLJGOSA-N |
| XLogP | 4.06 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|