C24H25N5O4 — CID 122294604
7-methoxy-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 122294604) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 7-methoxy-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122294604 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 7-methoxy-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cc4cccc(OC)c4o3)n2)cc1 |
| InChI | InChI=1S/C24H25N5O4/c1-15-13-21(28-17-7-9-18(31-2)10-8-17)29-24(27-15)26-12-11-25-23(30)20-14-16-5-4-6-19(32-3)22(16)33-20/h4-10,13-14H,11-12H2,1-3H3,(H,25,30)(H2,26,27,28,29) |
| InChIKey | BTVDEWLBKSMXMS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|