C19H22N6O2S — CID 122294733
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 122294733) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122294733 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3scnc3C)n2)cc1 |
| InChI | InChI=1S/C19H22N6O2S/c1-12-10-16(24-14-4-6-15(27-3)7-5-14)25-19(23-12)21-9-8-20-18(26)17-13(2)22-11-28-17/h4-7,10-11H,8-9H2,1-3H3,(H,20,26)(H2,21,23,24,25) |
| InChIKey | PWYHKLFSGUGOHH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|