C20H23N7O3 — CID 122294606
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 122294606) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 122294606 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3ccc(=O)n(C)n3)n2)cc1 |
| InChI | InChI=1S/C20H23N7O3/c1-13-12-17(24-14-4-6-15(30-3)7-5-14)25-20(23-13)22-11-10-21-19(29)16-8-9-18(28)27(2)26-16/h4-9,12H,10-11H2,1-3H3,(H,21,29)(H2,22,23,24,25) |
| InChIKey | WZQICESHFISTHF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|