C21H22N4O4 — CID 113194304
4-[[2-[2-(4-methoxyphenoxy)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194304) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[[2-[2-(4-methoxyphenoxy)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-(4-methoxyphenoxy)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194304 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[[2-[2-(4-methoxyphenoxy)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1ccc(OCCNc2nc(C)cc(Nc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-14-13-19(24-16-5-3-15(4-6-16)20(26)27)25-21(23-14)22-11-12-29-18-9-7-17(28-2)8-10-18/h3-10,13H,11-12H2,1-2H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | GLCLLEQJMRCABT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|