C21H21ClN6O4 — CID 121075125
2-chloro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-nitrobenzamide (PubChem CID 121075125) has the molecular formula C21H21ClN6O4 and a molecular weight of 456.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 121075125 |
| Molecular Formula | C21H21ClN6O4 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-chloro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-nitrobenzamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3ccc([N+](=O)[O-])cc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H21ClN6O4/c1-13-11-19(26-14-3-6-16(32-2)7-4-14)27-21(25-13)24-10-9-23-20(29)17-8-5-15(28(30)31)12-18(17)22/h3-8,11-12H,9-10H2,1-2H3,(H,23,29)(H2,24,25,26,27) |
| InChIKey | TVSQVSZZYZQPQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|