C19H28N6O4 — CID 122324795
1-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 122324795) has the molecular formula C19H28N6O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 122324795 |
| Molecular Formula | C19H28N6O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C19H28N6O4/c1-6-20-16-9-12(2)23-18(25-16)21-7-8-22-19(26)24-13-10-14(27-3)17(29-5)15(11-13)28-4/h9-11H,6-8H2,1-5H3,(H2,22,24,26)(H2,20,21,23,25) |
| InChIKey | ZUEVOHZAJIEUAO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|