C18H26N6O2 — CID 122324509
1-(4-ethoxyphenyl)-3-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]urea (PubChem CID 122324509) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122324509 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)Nc2ccc(OCC)cc2)n1 |
| InChI | InChI=1S/C18H26N6O2/c1-4-19-16-12-13(3)22-17(24-16)20-10-11-21-18(25)23-14-6-8-15(9-7-14)26-5-2/h6-9,12H,4-5,10-11H2,1-3H3,(H2,21,23,25)(H2,19,20,22,24) |
| InChIKey | ZOWOOVLCZLFGSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|