C17H20F3N5O2 — CID 122324631
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 122324631) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122324631 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H20F3N5O2/c1-3-21-14-10-11(2)24-16(25-14)23-9-8-22-15(26)12-4-6-13(7-5-12)27-17(18,19)20/h4-7,10H,3,8-9H2,1-2H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | QFMRHZCVTVNRRA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|