C16H19F3N6O — CID 122324641
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 122324641) has the molecular formula C16H19F3N6O and a molecular weight of 368.36 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122324641 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)c2ccc(C(F)(F)F)nc2)n1 |
| InChI | InChI=1S/C16H19F3N6O/c1-3-20-13-8-10(2)24-15(25-13)22-7-6-21-14(26)11-4-5-12(23-9-11)16(17,18)19/h4-5,8-9H,3,6-7H2,1-2H3,(H,21,26)(H2,20,22,24,25) |
| InChIKey | MUIFSXVJIHLPML-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|