C19H28N4O3 — CID 112925562
6-methyl-2-N-pentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112925562) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 6-methyl-2-N-pentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-pentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112925562 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 6-methyl-2-N-pentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(C)cc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C19H28N4O3/c1-6-7-8-9-20-19-21-13(2)10-17(23-19)22-14-11-15(24-3)18(26-5)16(12-14)25-4/h10-12H,6-9H2,1-5H3,(H2,20,21,22,23) |
| InChIKey | QRCIYOGVRKWVCC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|