C19H28N4O2 — CID 112922720
4-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine (PubChem CID 112922720) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112922720 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(C)cc(NCc2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C19H28N4O2/c1-5-6-7-10-20-19-22-14(2)11-18(23-19)21-13-15-8-9-16(24-3)17(12-15)25-4/h8-9,11-12H,5-7,10,13H2,1-4H3,(H2,20,21,22,23) |
| InChIKey | XDXDPFGZKIZWFI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|