C44H54N12O8 — CID 177395359
6-N-[2-[[4,6-bis[(3,4-dimethoxyphenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethyl]-2-N,4-N-bis[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 177395359) has the molecular formula C44H54N12O8 and a molecular weight of 878.99 g/mol. Its IUPAC name is 6-N-[2-[[4,6-bis[(3,4-dimethoxyphenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethyl]-2-N,4-N-bis[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[[4,6-bis[(3,4-dimethoxyphenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethyl]-2-N,4-N-bis[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 177395359 |
| Molecular Formula | C44H54N12O8 |
| Molecular Weight | 878.99 g/mol |
| Exact Mass | 878.42 |
| IUPAC Name | 6-N-[2-[[4,6-bis[(3,4-dimethoxyphenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethyl]-2-N,4-N-bis[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(CNc2nc(NCCNc3nc(NCc4ccc(OC)c(OC)c4)nc(NCc4ccc(OC)c(OC)c4)n3)nc(NCc3ccc(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C44H54N12O8/c1-57-31-13-9-27(19-35(31)61-5)23-47-41-51-39(52-42(55-41)48-24-28-10-14-32(58-2)36(20-28)62-6)45-17-18-46-40-53-43(49-25-29-11-15-33(59-3)37(21-29)63-7)56-44(54-40)50-26-30-12-16-34(60-4)38(22-30)64-8/h9-16,19-22H,17-18,23-26H2,1-8H3,(H3,45,47,48,51,52,55)(H3,46,49,50,53,54,56) |
| InChIKey | OYFFCWZWZSEBSR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 223.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.99 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|