C13H16N2O3 — CID 75355483
N-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,2-oxazol-3-amine (PubChem CID 75355483) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,2-oxazol-3-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 75355483 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,2-oxazol-3-amine |
| SMILES | COc1ccc(CNc2cc(C)on2)cc1OC |
| InChI | InChI=1S/C13H16N2O3/c1-9-6-13(15-18-9)14-8-10-4-5-11(16-2)12(7-10)17-3/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | SAFOQHIMBYNEME-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |