C11H14N4O3 — CID 103436661
2-N-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103436661) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-N-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103436661 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazole-2,5-diamine |
| SMILES | COc1ccc(CNc2nnc(N)o2)cc1OC |
| InChI | InChI=1S/C11H14N4O3/c1-16-8-4-3-7(5-9(8)17-2)6-13-11-15-14-10(12)18-11/h3-5H,6H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | LUCJESNZEKCSND-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |