C13H15BrN4O2 — CID 80787012
5-bromo-4-N-[(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 80787012) has the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. Its IUPAC name is 5-bromo-4-N-[(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-[(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80787012 |
| Molecular Formula | C13H15BrN4O2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-bromo-4-N-[(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(CNc2nc(N)ncc2Br)cc1OC |
| InChI | InChI=1S/C13H15BrN4O2/c1-19-10-4-3-8(5-11(10)20-2)6-16-12-9(14)7-17-13(15)18-12/h3-5,7H,6H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | PDEMVOJGEJITRO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |