C12H11BrN4O2 — CID 80824506
4-N-(1,3-benzodioxol-5-ylmethyl)-5-bromopyrimidine-2,4-diamine (PubChem CID 80824506) has the molecular formula C12H11BrN4O2 and a molecular weight of 323.15 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-5-bromopyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-5-bromopyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80824506 |
| Molecular Formula | C12H11BrN4O2 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-5-bromopyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Br)c(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H11BrN4O2/c13-8-5-16-12(14)17-11(8)15-4-7-1-2-9-10(3-7)19-6-18-9/h1-3,5H,4,6H2,(H3,14,15,16,17) |
| InChIKey | VGEKGKZQMIKNJU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |