C13H15BrN4 — CID 106900943
5-bromo-4-N-[(4-ethylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 106900943) has the molecular formula C13H15BrN4 and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-bromo-4-N-[(4-ethylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-[(4-ethylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106900943 |
| Molecular Formula | C13H15BrN4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-bromo-4-N-[(4-ethylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCc1ccc(CNc2nc(N)ncc2Br)cc1 |
| InChI | InChI=1S/C13H15BrN4/c1-2-9-3-5-10(6-4-9)7-16-12-11(14)8-17-13(15)18-12/h3-6,8H,2,7H2,1H3,(H3,15,16,17,18) |
| InChIKey | PUKSYIIZBAJWRB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |