C9H9BrN4S — CID 80828399
5-bromo-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 80828399) has the molecular formula C9H9BrN4S and a molecular weight of 285.17 g/mol. Its IUPAC name is 5-bromo-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80828399 |
| Molecular Formula | C9H9BrN4S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 5-bromo-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Br)c(NCc2ccsc2)n1 |
| InChI | InChI=1S/C9H9BrN4S/c10-7-4-13-9(11)14-8(7)12-3-6-1-2-15-5-6/h1-2,4-5H,3H2,(H3,11,12,13,14) |
| InChIKey | AOGNFQLUEZYEHB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |