C10H10ClN3S — CID 115474154
6-chloro-2-N-(thiophen-3-ylmethyl)pyridine-2,3-diamine (PubChem CID 115474154) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 6-chloro-2-N-(thiophen-3-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(thiophen-3-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474154 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 6-chloro-2-N-(thiophen-3-ylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NCc1ccsc1 |
| InChI | InChI=1S/C10H10ClN3S/c11-9-2-1-8(12)10(14-9)13-5-7-3-4-15-6-7/h1-4,6H,5,12H2,(H,13,14) |
| InChIKey | NLGCHMDHNNOMOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|