C8H12ClN3O — CID 115473663
3-[(3-amino-6-chloro-2-pyridinyl)amino]propan-1-ol (PubChem CID 115473663) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 3-[(3-amino-6-chloro-2-pyridinyl)amino]propan-1-ol.
| Compound Name | 3-[(3-amino-6-chloro-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 115473663 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-[(3-amino-6-chloro-2-pyridinyl)amino]propan-1-ol |
| SMILES | Nc1ccc(Cl)nc1NCCCO |
| InChI | InChI=1S/C8H12ClN3O/c9-7-3-2-6(10)8(12-7)11-4-1-5-13/h2-3,13H,1,4-5,10H2,(H,11,12) |
| InChIKey | JBBGGEDNWUTEQJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|