C11H18ClN3O2 — CID 114097569
6-chloro-2-N-[3-(2-methoxyethoxy)propyl]pyridine-2,3-diamine (PubChem CID 114097569) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 6-chloro-2-N-[3-(2-methoxyethoxy)propyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[3-(2-methoxyethoxy)propyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 114097569 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-chloro-2-N-[3-(2-methoxyethoxy)propyl]pyridine-2,3-diamine |
| SMILES | COCCOCCCNc1nc(Cl)ccc1N |
| InChI | InChI=1S/C11H18ClN3O2/c1-16-7-8-17-6-2-5-14-11-9(13)3-4-10(12)15-11/h3-4H,2,5-8,13H2,1H3,(H,14,15) |
| InChIKey | KFEKZPILEUTOPC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|