C14H23Cl2N3O2 — CID 102759816
3,5-dichloro-2-N-ethyl-6-N-[4-(2-methoxyethoxy)butyl]pyridine-2,6-diamine (PubChem CID 102759816) has the molecular formula C14H23Cl2N3O2 and a molecular weight of 336.26 g/mol. Its IUPAC name is 3,5-dichloro-2-N-ethyl-6-N-[4-(2-methoxyethoxy)butyl]pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-ethyl-6-N-[4-(2-methoxyethoxy)butyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759816 |
| Molecular Formula | C14H23Cl2N3O2 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3,5-dichloro-2-N-ethyl-6-N-[4-(2-methoxyethoxy)butyl]pyridine-2,6-diamine |
| SMILES | CCNc1nc(NCCCCOCCOC)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H23Cl2N3O2/c1-3-17-13-11(15)10-12(16)14(19-13)18-6-4-5-7-21-9-8-20-2/h10H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | BXAROVXHAYMOGN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|