C14H22Cl2N2O3 — CID 103408318
3,5-dichloro-6-[3-(2-methoxyethoxy)propoxy]-N-propylpyridin-2-amine (PubChem CID 103408318) has the molecular formula C14H22Cl2N2O3 and a molecular weight of 337.25 g/mol. Its IUPAC name is 3,5-dichloro-6-[3-(2-methoxyethoxy)propoxy]-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-[3-(2-methoxyethoxy)propoxy]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 103408318 |
| Molecular Formula | C14H22Cl2N2O3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3,5-dichloro-6-[3-(2-methoxyethoxy)propoxy]-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(OCCCOCCOC)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O3/c1-3-5-17-13-11(15)10-12(16)14(18-13)21-7-4-6-20-9-8-19-2/h10H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | XUVPRZDTZKQZNM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|