C13H21Cl2N3O — CID 102760859
3,5-dichloro-6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine (PubChem CID 102760859) has the molecular formula C13H21Cl2N3O and a molecular weight of 306.24 g/mol. Its IUPAC name is 3,5-dichloro-6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 102760859 |
| Molecular Formula | C13H21Cl2N3O |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3,5-dichloro-6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(OCCCN(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H21Cl2N3O/c1-4-6-16-12-10(14)9-11(15)13(17-12)19-8-5-7-18(2)3/h9H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | UHLZKQPCAVHLHC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|