C16H27Cl2N3 — CID 102754456
6-N,6-N-dibutyl-3,5-dichloro-2-N-propylpyridine-2,6-diamine (PubChem CID 102754456) has the molecular formula C16H27Cl2N3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 6-N,6-N-dibutyl-3,5-dichloro-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N,6-N-dibutyl-3,5-dichloro-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102754456 |
| Molecular Formula | C16H27Cl2N3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 6-N,6-N-dibutyl-3,5-dichloro-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCCN(CCCC)c1nc(NCCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H27Cl2N3/c1-4-7-10-21(11-8-5-2)16-14(18)12-13(17)15(20-16)19-9-6-3/h12H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | ZYCKTMVFYSSRAB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |