C14H24Cl2N4 — CID 102757675
3,5-dichloro-6-N-[4-(dimethylamino)butyl]-2-N-propylpyridine-2,6-diamine (PubChem CID 102757675) has the molecular formula C14H24Cl2N4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 3,5-dichloro-6-N-[4-(dimethylamino)butyl]-2-N-propylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-[4-(dimethylamino)butyl]-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102757675 |
| Molecular Formula | C14H24Cl2N4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3,5-dichloro-6-N-[4-(dimethylamino)butyl]-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1nc(NCCCCN(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H24Cl2N4/c1-4-7-17-13-11(15)10-12(16)14(19-13)18-8-5-6-9-20(2)3/h10H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | MTHXRKPPILDABM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|