C15H23Cl3N2 — CID 102751515
3,5,6-trichloro-N-decylpyridin-2-amine (PubChem CID 102751515) has the molecular formula C15H23Cl3N2 and a molecular weight of 337.72 g/mol. Its IUPAC name is 3,5,6-trichloro-N-decylpyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-decylpyridin-2-amine |
|---|---|
| PubChem CID | 102751515 |
| Molecular Formula | C15H23Cl3N2 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3,5,6-trichloro-N-decylpyridin-2-amine |
| SMILES | CCCCCCCCCCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H23Cl3N2/c1-2-3-4-5-6-7-8-9-10-19-15-13(17)11-12(16)14(18)20-15/h11H,2-10H2,1H3,(H,19,20) |
| InChIKey | PSQUVXMSZCAWRT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|