About N-but-3-enyl-3,5,6-trichloropyridin-2-amine
N-but-3-enyl-3,5,6-trichloropyridin-2-amine (PubChem CID 106196171) has the molecular formula C9H9Cl3N2
and a molecular weight of 251.54 g/mol. Its IUPAC name is N-but-3-enyl-3,5,6-trichloropyridin-2-amine.
Molecular Properties
| Compound Name | N-but-3-enyl-3,5,6-trichloropyridin-2-amine |
| PubChem CID | 106196171 |
| Molecular Formula | C9H9Cl3N2 |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | N-but-3-enyl-3,5,6-trichloropyridin-2-amine |
| SMILES | C=CCCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N2/c1-2-3-4-13-9-7(11)5-6(10)8(12)14-9/h2,5H,1,3-4H2,(H,13,14) |
| InChIKey | KWPZSSIJVXOPCO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-3,5,6-trichloropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-3,5,6-trichloropyridin-2-amine?
The IUPAC name of N-but-3-enyl-3,5,6-trichloropyridin-2-amine (CID 106196171) is N-but-3-enyl-3,5,6-trichloropyridin-2-amine.
What is the SMILES notation for N-but-3-enyl-3,5,6-trichloropyridin-2-amine?
The canonical SMILES for N-but-3-enyl-3,5,6-trichloropyridin-2-amine is C=CCCNc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of N-but-3-enyl-3,5,6-trichloropyridin-2-amine?
The InChIKey is KWPZSSIJVXOPCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl3N2/c1-2-3-4-13-9-7(11)5-6(10)8(12)14-9/h2,5H,1,3-4H2,(H,13,14).
What are the key properties of N-but-3-enyl-3,5,6-trichloropyridin-2-amine?
N-but-3-enyl-3,5,6-trichloropyridin-2-amine has a molecular weight of 251.54 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-3,5,6-trichloropyridin-2-amine is sourced from PubChem (CID 106196171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).