C9H8Cl3N5 — CID 106195168
3,5,6-trichloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106195168) has the molecular formula C9H8Cl3N5 and a molecular weight of 292.56 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106195168 |
| Molecular Formula | C9H8Cl3N5 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 3,5,6-trichloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NCCc2ncn[nH]2)nc1Cl |
| InChI | InChI=1S/C9H8Cl3N5/c10-5-3-6(11)9(16-8(5)12)13-2-1-7-14-4-15-17-7/h3-4H,1-2H2,(H,13,16)(H,14,15,17) |
| InChIKey | NWAXOYUUFGJDIY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|