C9H10ClN7O2 — CID 106195182
2-chloro-6-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyrimidin-4-amine (PubChem CID 106195182) has the molecular formula C9H10ClN7O2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 2-chloro-6-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106195182 |
| Molecular Formula | C9H10ClN7O2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-chloro-6-methyl-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)nc(NCCc2ncn[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN7O2/c1-5-7(17(18)19)8(15-9(10)14-5)11-3-2-6-12-4-13-16-6/h4H,2-3H2,1H3,(H,11,14,15)(H,12,13,16) |
| InChIKey | BAWUPUTVMQYHCE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|