C9H13ClN8 — CID 114156731
6-chloro-2-N,2-N-dimethyl-4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 114156731) has the molecular formula C9H13ClN8 and a molecular weight of 268.71 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-dimethyl-4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-dimethyl-4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 114156731 |
| Molecular Formula | C9H13ClN8 |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-chloro-2-N,2-N-dimethyl-4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(Cl)nc(NCCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C9H13ClN8/c1-18(2)9-15-7(10)14-8(16-9)11-4-3-6-12-5-13-17-6/h5H,3-4H2,1-2H3,(H,12,13,17)(H,11,14,15,16) |
| InChIKey | FGWIQLAIJZNKRF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |