C9H11ClN6 — CID 104924795
6-chloro-2-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2,4-diamine (PubChem CID 104924795) has the molecular formula C9H11ClN6 and a molecular weight of 238.68 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104924795 |
| Molecular Formula | C9H11ClN6 |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6-chloro-2-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(NCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C9H11ClN6/c10-7-3-6(11)4-9(15-7)12-2-1-8-13-5-14-16-8/h3-5H,1-2H2,(H3,11,12,15)(H,13,14,16) |
| InChIKey | JLPSBPACQRUABT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|