C9H12ClF2N3O — CID 103081629
6-chloro-2-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2,4-diamine (PubChem CID 103081629) has the molecular formula C9H12ClF2N3O and a molecular weight of 251.66 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 103081629 |
| Molecular Formula | C9H12ClF2N3O |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 6-chloro-2-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(NCCOCC(F)F)c1 |
| InChI | InChI=1S/C9H12ClF2N3O/c10-7-3-6(13)4-9(15-7)14-1-2-16-5-8(11)12/h3-4,8H,1-2,5H2,(H3,13,14,15) |
| InChIKey | OPQQRXLPNPMGAT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|