C9H12ClN3 — CID 104918835
6-chloro-2-N-(cyclopropylmethyl)pyridine-2,4-diamine (PubChem CID 104918835) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 6-chloro-2-N-(cyclopropylmethyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(cyclopropylmethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104918835 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-chloro-2-N-(cyclopropylmethyl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(NCC2CC2)c1 |
| InChI | InChI=1S/C9H12ClN3/c10-8-3-7(11)4-9(13-8)12-5-6-1-2-6/h3-4,6H,1-2,5H2,(H3,11,12,13) |
| InChIKey | FDHFIGQVQAFMRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|