C11H17ClN4 — CID 106022889
6-chloro-2-N-[(1-methylpyrrolidin-2-yl)methyl]pyridine-2,4-diamine (PubChem CID 106022889) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 6-chloro-2-N-[(1-methylpyrrolidin-2-yl)methyl]pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(1-methylpyrrolidin-2-yl)methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 106022889 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 6-chloro-2-N-[(1-methylpyrrolidin-2-yl)methyl]pyridine-2,4-diamine |
| SMILES | CN1CCCC1CNc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C11H17ClN4/c1-16-4-2-3-9(16)7-14-11-6-8(13)5-10(12)15-11/h5-6,9H,2-4,7H2,1H3,(H3,13,14,15) |
| InChIKey | FUCISRMJVMRWHZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|