C10H15ClN4 — CID 131214051
5-chloro-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazin-2-amine (PubChem CID 131214051) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 5-chloro-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazin-2-amine.
| Compound Name | 5-chloro-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 131214051 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-chloro-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazin-2-amine |
| SMILES | CN1CCCC1CNc1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H15ClN4/c1-15-4-2-3-8(15)5-13-10-7-12-9(11)6-14-10/h6-8H,2-5H2,1H3,(H,13,14) |
| InChIKey | LRLKVHRWKOHZMV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |