C11H16FN3 — CID 106026754
5-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine (PubChem CID 106026754) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine.
| Compound Name | 5-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106026754 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 5-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine |
| SMILES | CN1CCCC1CNc1ccc(F)cn1 |
| InChI | InChI=1S/C11H16FN3/c1-15-6-2-3-10(15)8-14-11-5-4-9(12)7-13-11/h4-5,7,10H,2-3,6,8H2,1H3,(H,13,14) |
| InChIKey | BQWHSESCJXFOOD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |