C10H14FN3 — CID 62542199
5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine (PubChem CID 62542199) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is 5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62542199 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
| SMILES | Fc1ccc(NCC2CCCN2)nc1 |
| InChI | InChI=1S/C10H14FN3/c11-8-3-4-10(13-6-8)14-7-9-2-1-5-12-9/h3-4,6,9,12H,1-2,5,7H2,(H,13,14) |
| InChIKey | WBKPVKOKPFYGOR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |