C24H25FN4O2 — CID 58926080
(3E)-3-[5,5-dimethyl-4-[6-[[(2S)-pyrrolidin-2-yl]methylamino]-3-pyridinyl]furan-2-ylidene]-5-fluoro-1H-indol-2-one (PubChem CID 58926080) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is (3E)-3-[5,5-dimethyl-4-[6-[[(2S)-pyrrolidin-2-yl]methylamino]-3-pyridinyl]furan-2-ylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-[5,5-dimethyl-4-[6-[[(2S)-pyrrolidin-2-yl]methylamino]-3-pyridinyl]furan-2-ylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 58926080 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (3E)-3-[5,5-dimethyl-4-[6-[[(2S)-pyrrolidin-2-yl]methylamino]-3-pyridinyl]furan-2-ylidene]-5-fluoro-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3ccc(F)cc32)C=C1c1ccc(NC[C@@H]2CCCN2)nc1 |
| InChI | InChI=1S/C24H25FN4O2/c1-24(2)18(14-5-8-21(27-12-14)28-13-16-4-3-9-26-16)11-20(31-24)22-17-10-15(25)6-7-19(17)29-23(22)30/h5-8,10-12,16,26H,3-4,9,13H2,1-2H3,(H,27,28)(H,29,30)/b22-20+/t16-/m0/s1 |
| InChIKey | KLMBPIUFUWJJCF-JDAKFOBDSA-N |
| XLogP | 3.94 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|