C25H25FN4O4 — CID 69446416
2-[4-[5-[5-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]piperazin-1-yl]acetic acid (PubChem CID 69446416) has the molecular formula C25H25FN4O4 and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-[4-[5-[5-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[5-[5-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 69446416 |
| Molecular Formula | C25H25FN4O4 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[4-[5-[5-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]piperazin-1-yl]acetic acid |
| SMILES | CC1(C)OC(=C2C(=O)Nc3ccc(F)cc32)C=C1c1ccc(N2CCN(CC(=O)O)CC2)nc1 |
| InChI | InChI=1S/C25H25FN4O4/c1-25(2)18(12-20(34-25)23-17-11-16(26)4-5-19(17)28-24(23)33)15-3-6-21(27-13-15)30-9-7-29(8-10-30)14-22(31)32/h3-6,11-13H,7-10,14H2,1-2H3,(H,28,33)(H,31,32) |
| InChIKey | QPGYUCKKEGXGAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|