C22H18FNO4 — CID 58926197
2-[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]acetic acid (PubChem CID 58926197) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 58926197 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]acetic acid |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C22H18FNO4/c1-22(2)16(13-5-3-12(4-6-13)9-19(25)26)11-18(28-22)20-15-8-7-14(23)10-17(15)24-21(20)27/h3-8,10-11H,9H2,1-2H3,(H,24,27)(H,25,26)/b20-18+ |
| InChIKey | XCIYYKZKWCNNJC-CZIZESTLSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|